BDBM112288 US8623889, 286
SMILES Cc1ccncc1-c1ccc2cc(NC(=O)C3C[C@H]3F)ncc2c1
InChI Key InChIKey=ZAUJQZWLDBQKEZ-UHFFFAOYSA-N
Data 2 KI
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 112288
Affinity DataKi: 0.0300nMAssay Description:Using the following procedure, varying concentration of compounds of the invention were assessed for their ability to inhibit c-Abl enzyme's phos...More data for this Ligand-Target Pair
Affinity DataKi: 0.0700nMAssay Description:Using the following procedure, varying concentration of compounds of the invention were assessed for their ability to inhibit c-Abl enzyme's phos...More data for this Ligand-Target Pair
