BDBM150733 4‐chloro‐2‐[(4‐fluorophenyl)carbamoyl]phenyl diethyl phosphate (13)
SMILES CCOP(=O)(OCC)Oc1ccc(Cl)cc1C(=O)Nc1ccc(F)cc1
InChI Key InChIKey=WYJLXHQRDQDUOM-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 150733
Affinity DataIC50: 4.85E+4nMAssay Description:The reaction mixture containing phosphate buffer, AChE or BChE and chosen compounds was prepared and intensively stirred. In given times (5, 10, 15, ...More data for this Ligand-Target Pair
Affinity DataIC50: 2.05E+4nMAssay Description:The reaction mixture containing phosphate buffer, AChE or BChE and chosen compounds was prepared and intensively stirred. In given times (5, 10, 15, ...More data for this Ligand-Target Pair
