BDBM155872 US10093663, Example 2b::US9682968, Example-1
SMILES Cc1cc(C)c2[nH]ccc2c1CN1CCC(O)CC1c1ccccc1
InChI Key InChIKey=JTBTYGJFYMKDQG-UHFFFAOYSA-N
Data 6 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 6 hits for monomerid = 155872
Affinity DataIC50: 100nMAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 uM), recombinant human complement factor B (expressed in drosophila cells and purified us...More data for this Ligand-Target Pair
Affinity DataIC50: 7.90E+3nMpH: 7.4 T: 2°CAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
Affinity DataIC50: 1.40E+4nMAssay Description:Inhibition of human serine protease factor B catalytic domain (D470 to L764 residues) assessed as inhibition of cleavage cobra venom factor (CVF):Bb ...More data for this Ligand-Target Pair
Affinity DataIC50: 1.00E+5nMpH: 7.4 T: 2°CAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
Affinity DataIC50: 1.00E+5nMpH: 7.4 T: 2°CAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
Affinity DataIC50: 1.00E+5nMAssay Description:Inhibition of human serine protease factor B by TR-FRET based competition binding assayMore data for this Ligand-Target Pair
