BDBM18887 3,5-Dibromo-4-alkoxyphenylalkanoic Acid, 9k::3-[3,5-dibromo-4-(cyclohexylmethoxy)phenyl]propanoic acid::JMC496635 Compound 9::cyclohexyl derivative, 7
SMILES OC(=O)CCc1cc(Br)c(OCC2CCCCC2)c(Br)c1
InChI Key InChIKey=UQABRPIJAIHKQN-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 7 hits for monomerid = 18887
Affinity DataIC50: 190nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta.More data for this Ligand-Target Pair
Affinity DataIC50: 460nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. More data for this Ligand-Target Pair
Affinity DataIC50: 460nM EC50: 0.530nMpH: 7.0 T: 2°CAssay Description:IIC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to...More data for this Ligand-Target Pair
Affinity DataIC50: 190nM EC50: 0.120nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to i...More data for this Ligand-Target Pair
Affinity DataIC50: 460nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. More data for this Ligand-Target Pair
Affinity DataIC50: 190nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta.More data for this Ligand-Target Pair
Affinity DataIC50: 191nMAssay Description:Inhibition of human thyroid hormone receptor beta 1More data for this Ligand-Target Pair
