BDBM18894 3-{3,5-dibromo-4-[(3-bromophenyl)methoxy]phenyl}propanoic acid::benzyl derivative, 11f
SMILES OC(=O)CCc1cc(Br)c(OCc2cccc(Br)c2)c(Br)c1
InChI Key InChIKey=LKIKBJBECFALSP-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 18894
Affinity DataIC50: 60nM EC50: 230nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to r...More data for this Ligand-Target Pair
Affinity DataIC50: 99nM EC50: 380nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to ...More data for this Ligand-Target Pair
