BDBM18896 3-(3,5-dibromo-4-{[3-(ethylamino)phenyl]methoxy}phenyl)propanoic acid::benzyl derivative, 14
SMILES CCNc1cccc(COc2c(Br)cc(CCC(O)=O)cc2Br)c1
InChI Key InChIKey=HNHRKBWCJIABCS-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 18896
Affinity DataIC50: 23nM EC50: 49nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to r...More data for this Ligand-Target Pair
Affinity DataIC50: 78nM EC50: 23nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to ...More data for this Ligand-Target Pair
