BDBM286216 6-methyl-2-(6-methylpyridin-3- yl)-3-methylimidazo[1,2- a]pyridine::US9518055, Example 14
SMILES Cc1c(nc2ccc(C)cn12)-c1cnccc1C
InChI Key InChIKey=JKAPIQCSOBKHFE-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 286216
Affinity DataIC50: 9.10nMAssay Description:V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfection protocol. V79 ...More data for this Ligand-Target Pair
Affinity DataIC50: 2.40E+3nMAssay Description:V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfection protocol. V79 ...More data for this Ligand-Target Pair
