BDBM286221 6-fluoro-3-methyl-2-(5- methoxypyridin-3- yl)imidazo[1,2-a]pyridine::US9518055, Example 18
SMILES COc1cncc(c1)-c1nc2ccc(F)cn2c1C
InChI Key InChIKey=SZBAIFHYRBMLFH-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 286221
Affinity DataIC50: 0.300nMAssay Description:V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfection protocol. V79 ...More data for this Ligand-Target Pair
Affinity DataIC50: 32.4nMAssay Description:V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfection protocol. V79 ...More data for this Ligand-Target Pair
