BDBM761309 CHEM-US-00311 4-(2-((5-methoxy-7-methyl-1H-indol-4- yl)methyl)hexahydro-1H- spiro[cyclopenta[c]pyrrole-5,1'- cyclopropan]-1-yl)benzoic acid::US20250243186, Example 29
SMILES COc1cc(C(=O)O)c2[nH]ccc2c1CN1CC2CC3(CC3)CC2C1c1ccccc1
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 3 hits for monomerid = 761309
Affinity DataKd: 7.03nMAssay Description:Table 2: Biacore 8 k instrument was primed using 1× PBS-P+ buffer before docking a Cytiva NTA chip. Recombinant human Factor B catalytic domain were ...More data for this Ligand-Target Pair
Affinity DataIC50: 7.5nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
Affinity DataIC50: 43.7nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
