BDBM761312 CHEM-US-00320 4-((3aR,6aS)-2-((5-methoxy-7-methyl- 1H-indol-4-yl)methyl)-5,5- dimethyloctahydrocyclopenta[c]pyrrol- 1-yl)benzoic acid::US20250243186, Example 34
SMILES COc1cc(C)c2[nH]ccc2c1CN1C[C@@H]2CC(C)(C)C[C@@H]2C1c1ccc(C(=O)O)cc1
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 761312
Affinity DataIC50: 7.70nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
Affinity DataIC50: 180nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
